
CAS 1356087-94-9
:3-(5-Methyl-2-pyridinyl)-5-nitro-1H-indazole
Description:
3-(5-Methyl-2-pyridinyl)-5-nitro-1H-indazole is a chemical compound characterized by its complex structure, which includes an indazole core substituted with a nitro group and a pyridine ring. The presence of the 5-methyl-2-pyridinyl group contributes to its unique chemical properties, potentially influencing its reactivity and biological activity. The nitro group is known for its electron-withdrawing properties, which can affect the compound's overall polarity and solubility in various solvents. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, the compound's stability, melting point, and solubility characteristics would be essential for practical applications, including formulation in drug development. Overall, 3-(5-Methyl-2-pyridinyl)-5-nitro-1H-indazole represents a class of compounds that may have significant implications in research and development within the fields of chemistry and pharmacology.
Formula:C13H10N4O2
InChI:InChI=1S/C13H10N4O2/c1-8-2-4-12(14-7-8)13-10-6-9(17(18)19)3-5-11(10)15-16-13/h2-7H,1H3,(H,15,16)
InChI key:InChIKey=JYWIARCFWALNAT-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C=C2C(=NNC2=CC1)C3=CC=C(C)C=N3
Synonyms:- 1H-Indazole, 3-(5-methyl-2-pyridinyl)-5-nitro-
- 3-(5-Methyl-2-pyridinyl)-5-nitro-1H-indazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
