CAS 1356087-98-3
:3-(5-Chloro-2-pyridinyl)-5-nitro-1H-indazole
Description:
3-(5-Chloro-2-pyridinyl)-5-nitro-1H-indazole is a chemical compound characterized by its complex structure, which includes an indazole core substituted with a nitro group and a chlorinated pyridine moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the presence of both nitro and chloro functional groups. The nitro group can influence the compound's electronic properties, making it a candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the chlorinated pyridine ring may impart specific biological activities, making this compound of interest in pharmaceutical research. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. As with many heterocyclic compounds, the stability and reactivity can vary based on environmental conditions such as pH and temperature. Safety data should be consulted for handling and usage, as compounds with nitro and halogen substituents can pose health risks.
Formula:C12H7ClN4O2
InChI:InChI=1S/C12H7ClN4O2/c13-7-1-3-11(14-6-7)12-9-5-8(17(18)19)2-4-10(9)15-16-12/h1-6H,(H,15,16)
InChI key:InChIKey=RBAXEESELVKDSE-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C=C2C(=NNC2=CC1)C3=CC=C(Cl)C=N3
Synonyms:- 3-(5-Chloro-2-pyridinyl)-5-nitro-1H-indazole
- 1H-Indazole, 3-(5-chloro-2-pyridinyl)-5-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
