
CAS 1356089-40-1
:(1E)-5-(Methoxymethylamino)-1-phenyl-1-penten-3-one
Description:
(1E)-5-(Methoxymethylamino)-1-phenyl-1-penten-3-one is an organic compound characterized by its unique structural features, including a methoxymethylamino group and a phenyl group attached to a pentenone backbone. This compound typically exhibits properties associated with both amines and ketones, such as potential reactivity in nucleophilic addition reactions due to the presence of the carbonyl group. The methoxymethylamino substituent may influence its solubility and polarity, making it more soluble in organic solvents. Additionally, the presence of the phenyl group can contribute to the compound's stability and may affect its electronic properties, potentially allowing for interactions with biological targets. The compound's configuration as (1E) indicates a specific geometric arrangement around the double bond, which can influence its reactivity and interaction with other molecules. Overall, this compound may have applications in medicinal chemistry or as an intermediate in organic synthesis, although specific biological activities or uses would require further investigation.
Formula:C13H17NO2
InChI:InChI=1S/C13H17NO2/c1-14(16-2)11-10-13(15)9-8-12-6-4-3-5-7-12/h3-9H,10-11H2,1-2H3/b9-8+
InChI key:InChIKey=DJAOQKVGOGZYLH-CMDGGOBGSA-N
SMILES:C(=C/C(CCN(OC)C)=O)\C1=CC=CC=C1
Synonyms:- (1E)-5-(Methoxymethylamino)-1-phenyl-1-penten-3-one
- 1-Penten-3-one, 5-(methoxymethylamino)-1-phenyl-, (1E)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
