CAS 1356108-96-7

2,3-Pyridinedimethanol, 5-bromo-, hydrochloride (1:1)

Description:

2,3-Pyridinedimethanol, 5-bromo-, hydrochloride (1:1) is a chemical compound characterized by its pyridine ring structure, which is substituted with two hydroxymethyl groups at the 2 and 3 positions and a bromine atom at the 5 position. The hydrochloride form indicates that the compound is a salt formed with hydrochloric acid, enhancing its solubility in water and making it more stable for various applications. This compound may exhibit properties typical of both pyridine derivatives and alcohols, such as potential reactivity in nucleophilic substitution reactions due to the presence of hydroxymethyl groups. Its bromine substituent can also introduce unique reactivity patterns, making it useful in organic synthesis and medicinal chemistry. The presence of the hydrochloride salt form suggests potential applications in pharmaceuticals, where solubility and stability are critical. Overall, 2,3-Pyridinedimethanol, 5-bromo-, hydrochloride (1:1) is a versatile compound with potential utility in various chemical and biological contexts.

Formula: C₇H₈BrNO₂·ClH

InChI: InChI=1S/C7H8BrNO2.ClH/c8-6-1-5(3-10)7(4-11)9-2-6;/h1-2,10-11H,3-4H2;1H

InChI key: InChIKey=NGZZPLHLBIDOLU-UHFFFAOYSA-N

SMILES: C(O)C1=C(CO)C=C(Br)C=N1.Cl

Synonyms:

• [5-Bromo-3-(hydroxymethyl)pyridin-2-yl]methanol hydrochloride
• 2,3-Pyridinedimethanol, 5-bromo-, hydrochloride (1:1)