CAS 1356109-12-0
:4-Amino-6-methoxy-2(1H)-pyridinone
Description:
4-Amino-6-methoxy-2(1H)-pyridinone is an organic compound characterized by its pyridinone structure, which features a pyridine ring with an amino group and a methoxy group. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar solvents due to the presence of the amino and methoxy functional groups. The amino group can participate in hydrogen bonding, enhancing its reactivity and interaction with other molecules. The methoxy group contributes to the compound's overall polarity and can influence its electronic properties. In terms of applications, compounds of this nature may be explored in medicinal chemistry for their potential biological activities, including antimicrobial or anti-inflammatory effects. Additionally, the presence of the pyridinone moiety suggests potential utility in the development of pharmaceuticals or agrochemicals. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use.
Formula:C6H8N2O2
InChI:InChI=1S/C6H8N2O2/c1-10-6-3-4(7)2-5(9)8-6/h2-3H,1H3,(H3,7,8,9)
InChI key:InChIKey=WDVKHAFRSPTLGH-UHFFFAOYSA-N
SMILES:O(C)C1=CC(N)=CC(=O)N1
Synonyms:- 2(1H)-Pyridinone, 4-amino-6-methoxy-
- 4-Amino-6-methoxy-2(1H)-pyridinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
