CAS 1356109-15-3
:Phenylmethyl 3-hydroxy-3-(trifluoromethyl)-1-azetidinecarboxylate
Description:
Phenylmethyl 3-hydroxy-3-(trifluoromethyl)-1-azetidinecarboxylate, identified by its CAS number 1356109-15-3, is a chemical compound characterized by its azetidine ring structure, which is a four-membered cyclic amine. This compound features a trifluoromethyl group, contributing to its unique electronic properties and potential reactivity. The presence of a hydroxyl group indicates that it can participate in hydrogen bonding, which may influence its solubility and interaction with biological systems. The phenylmethyl group adds to its lipophilicity, potentially affecting its pharmacokinetic properties. This compound may exhibit interesting biological activities due to its structural features, making it a subject of interest in medicinal chemistry. Its synthesis and characterization would typically involve standard organic reactions, and its stability would depend on the specific conditions under which it is handled. Overall, the combination of functional groups and the azetidine framework suggests potential applications in drug development and materials science.
Formula:C12H12F3NO3
InChI:InChI=1S/C12H12F3NO3/c13-12(14,15)11(18)7-16(8-11)10(17)19-6-9-4-2-1-3-5-9/h1-5,18H,6-8H2
InChI key:InChIKey=KPFFRLDRDMMJNK-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1(O)CN(C(OCC2=CC=CC=C2)=O)C1
Synonyms:- Phenylmethyl 3-hydroxy-3-(trifluoromethyl)-1-azetidinecarboxylate
- Benzyl 3-hydroxy-3-(trifluoromethyl)azetidine-1-carboxylate
- 1-Azetidinecarboxylic acid, 3-hydroxy-3-(trifluoromethyl)-, phenylmethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Benzyl 3-hydroxy-3-(trifluoromethyl)azetidine-1-carboxylate
CAS:Formula:C12H12F3NO3Molecular weight:275.2238
