
CAS 1356109-22-2
:5-Bromo-2-(4-morpholinyl)-4-pyridinecarbonitrile
Description:
5-Bromo-2-(4-morpholinyl)-4-pyridinecarbonitrile is a chemical compound characterized by its unique structural features, which include a bromine atom, a morpholine ring, and a pyridine moiety with a cyano group. This compound typically exhibits properties associated with heterocyclic compounds, such as moderate solubility in polar solvents and potential reactivity due to the presence of the cyano group. The bromine substituent can influence its electronic properties and reactivity, making it a candidate for various chemical reactions, including nucleophilic substitutions. The morpholine group contributes to the compound's potential biological activity, as morpholines are often found in pharmacologically active compounds. Additionally, the presence of the pyridine ring may enhance the compound's ability to interact with biological targets, making it of interest in medicinal chemistry. Overall, 5-Bromo-2-(4-morpholinyl)-4-pyridinecarbonitrile is a versatile compound with potential applications in drug development and organic synthesis.
Formula:C10H10BrN3O
InChI:InChI=1S/C10H10BrN3O/c11-9-7-13-10(5-8(9)6-12)14-1-3-15-4-2-14/h5,7H,1-4H2
InChI key:InChIKey=JUQDHVLHMSIHDP-UHFFFAOYSA-N
SMILES:C(#N)C=1C=C(N=CC1Br)N2CCOCC2
Synonyms:- 5-Bromo-2-morpholinopyridine-4-carbonitrile
- 5-Bromo-2-(4-morpholinyl)-4-pyridinecarbonitrile
- 4-Pyridinecarbonitrile, 5-bromo-2-(4-morpholinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
