CAS 1356109-26-6
:2,3-Dimethyl 5-chloro-2,3-pyridinedicarboxylate
Description:
2,3-Dimethyl 5-chloro-2,3-pyridinedicarboxylate is a chemical compound characterized by its pyridine ring structure, which is substituted at specific positions with methyl and chloro groups, as well as carboxylate functional groups. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents, reflecting its polar nature due to the presence of carboxylate groups. The presence of chlorine and methyl groups can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Its molecular structure suggests potential applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. Additionally, the compound's stability and reactivity can be affected by environmental factors such as pH and temperature, which are important considerations in its handling and application. Safety data should be consulted to understand its toxicity and environmental impact, as with any chemical substance.
Formula:C9H8ClNO4
InChI:InChI=1S/C9H8ClNO4/c1-14-8(12)6-3-5(10)4-11-7(6)9(13)15-2/h3-4H,1-2H3
InChI key:InChIKey=OIRUWZGVELTEOV-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C(C(OC)=O)N=CC(Cl)=C1
Synonyms:- 2,3-Dimethyl 5-chloro-2,3-pyridinedicarboxylate
- 2,3-Pyridinedicarboxylic acid, 5-chloro-, 2,3-dimethyl ester
- 5-Chloropyridine-2,3-dicarboxylic Acid Dimethyl Ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
