CymitQuimica logo

CAS 1356109-39-1

:

5,6,7,8-Tetrahydro-7-(phenylmethyl)-2-(trifluoromethyl)-1,7-naphthyridine

Description:
5,6,7,8-Tetrahydro-7-(phenylmethyl)-2-(trifluoromethyl)-1,7-naphthyridine is a chemical compound characterized by its complex bicyclic structure, which includes a naphthyridine core. This compound features a tetrahydro configuration, indicating the presence of a saturated ring system, and a trifluoromethyl group, which significantly influences its chemical reactivity and physical properties. The phenylmethyl substituent adds to its structural diversity and may affect its interactions in biological systems. The trifluoromethyl group is known for enhancing lipophilicity and metabolic stability, making such compounds of interest in medicinal chemistry. The presence of multiple functional groups suggests potential applications in pharmaceuticals, particularly in the development of drugs targeting specific biological pathways. Additionally, the compound's unique structure may confer specific pharmacological properties, making it a candidate for further research in drug discovery and development. As with many organic compounds, its solubility, stability, and reactivity will depend on the surrounding conditions and the presence of other chemical entities.
Formula:C16H15F3N2
InChI:InChI=1S/C16H15F3N2/c17-16(18,19)15-7-6-13-8-9-21(11-14(13)20-15)10-12-4-2-1-3-5-12/h1-7H,8-11H2
InChI key:InChIKey=NYEBGBPLHYNMJI-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1N=C2C(CCN(CC3=CC=CC=C3)C2)=CC1
Synonyms:
  • 1,7-Naphthyridine, 5,6,7,8-tetrahydro-7-(phenylmethyl)-2-(trifluoromethyl)-
  • 5,6,7,8-Tetrahydro-7-(phenylmethyl)-2-(trifluoromethyl)-1,7-naphthyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.