
CAS 1356109-56-2
:1,2,3,4-Tetrahydro-6-(trifluoromethyl)-1,5-naphthyridine
Description:
1,2,3,4-Tetrahydro-6-(trifluoromethyl)-1,5-naphthyridine is a heterocyclic organic compound characterized by its bicyclic structure, which includes a naphthyridine moiety. This compound features a tetrahydro configuration, indicating that it contains a saturated ring system, and a trifluoromethyl group, which significantly influences its chemical properties and reactivity. The presence of the trifluoromethyl group enhances lipophilicity and can affect the compound's biological activity, making it of interest in medicinal chemistry. The molecular structure contributes to its potential as a pharmacophore in drug development, particularly in targeting specific biological pathways. Additionally, the compound may exhibit unique physical properties, such as solubility and stability, influenced by the trifluoromethyl substituent. Its CAS number, 1356109-56-2, allows for precise identification and retrieval of information regarding its synthesis, applications, and safety data in chemical databases. Overall, this compound represents a valuable entity in the field of organic and medicinal chemistry.
Formula:C9H9F3N2
InChI:InChI=1S/C9H9F3N2/c10-9(11,12)8-4-3-6-7(14-8)2-1-5-13-6/h3-4,13H,1-2,5H2
InChI key:InChIKey=JWONDTKRBQCXIG-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1N=C2C(=CC1)NCCC2
Synonyms:- 1,5-Naphthyridine, 1,2,3,4-tetrahydro-6-(trifluoromethyl)-
- 1,2,3,4-Tetrahydro-6-(trifluoromethyl)-1,5-naphthyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.