CAS 1356109-66-4
:5-Bromo-2-(dimethylamino)-4-pyridinecarbonitrile
Description:
5-Bromo-2-(dimethylamino)-4-pyridinecarbonitrile is a chemical compound characterized by its pyridine ring structure, which is substituted with a bromine atom and a dimethylamino group, as well as a cyano group. This compound typically exhibits properties associated with heterocyclic compounds, including potential solubility in polar organic solvents due to the presence of the dimethylamino group. The bromine atom introduces a halogen, which can enhance reactivity in nucleophilic substitution reactions. The cyano group contributes to the compound's polarity and can participate in various chemical reactions, such as nucleophilic addition or cycloaddition. Additionally, the presence of the pyridine ring suggests potential applications in medicinal chemistry, as pyridine derivatives are often explored for their biological activities. The compound's molecular structure may also influence its electronic properties, making it a candidate for studies in materials science or organic synthesis. Overall, 5-Bromo-2-(dimethylamino)-4-pyridinecarbonitrile is a versatile compound with potential applications in various fields of chemistry.
Formula:C8H8BrN3
InChI:InChI=1S/C8H8BrN3/c1-12(2)8-3-6(4-10)7(9)5-11-8/h3,5H,1-2H3
InChI key:InChIKey=RUJLDMYMIQIFMQ-UHFFFAOYSA-N
SMILES:C(#N)C=1C=C(N(C)C)N=CC1Br
Synonyms:- 4-Pyridinecarbonitrile, 5-bromo-2-(dimethylamino)-
- 5-Bromo-2-(dimethylamino)-4-pyridinecarbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
