CAS 1356109-72-2
:Pyridine, 5-chloro-2,3-bis(chloromethyl)-, hydrochloride (1:1)
Description:
Pyridine, 5-chloro-2,3-bis(chloromethyl)-, hydrochloride (1:1) is a chlorinated derivative of pyridine, characterized by the presence of multiple chlorine atoms and chloromethyl groups attached to the pyridine ring. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols due to the presence of the hydrochloride moiety. The chloromethyl groups enhance its reactivity, making it useful in various chemical synthesis applications, particularly in the production of more complex organic molecules. The presence of chlorine atoms can also impart unique properties, such as increased lipophilicity and potential biological activity. As with many chlorinated compounds, it is important to handle this substance with care due to potential toxicity and environmental concerns. Proper safety measures, including the use of personal protective equipment and adherence to regulatory guidelines, are essential when working with this chemical.
Formula:C7H6Cl3N·ClH
InChI:InChI=1S/C7H6Cl3N.ClH/c8-2-5-1-6(10)4-11-7(5)3-9;/h1,4H,2-3H2;1H
InChI key:InChIKey=LGJNSAWNKMNPRS-UHFFFAOYSA-N
SMILES:C(Cl)C1=C(CCl)C=C(Cl)C=N1.Cl
Synonyms:- Pyridine, 5-chloro-2,3-bis(chloromethyl)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
