CAS 1356109-90-4
:B-[6-(2,2,2-Trifluoroethyl)-3-pyridinyl]boronic acid
Description:
B-[6-(2,2,2-Trifluoroethyl)-3-pyridinyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a pyridine ring. This compound features a trifluoroethyl substituent at the 6-position of the pyridine, which contributes to its unique chemical properties, including increased lipophilicity and potential for hydrogen bonding. Boronic acids are known for their ability to form reversible covalent bonds with diols, making them valuable in various applications, including organic synthesis and medicinal chemistry. The trifluoroethyl group can enhance the compound's stability and influence its reactivity, particularly in the context of drug design and development. Additionally, the presence of the pyridine moiety may impart specific electronic properties, affecting the compound's interaction with biological targets. Overall, B-[6-(2,2,2-Trifluoroethyl)-3-pyridinyl]boronic acid is a versatile compound with potential applications in pharmaceuticals and materials science, owing to its unique structural features and reactivity profile.
Formula:C7H7BF3NO2
InChI:InChI=1S/C7H7BF3NO2/c9-7(10,11)3-6-2-1-5(4-12-6)8(13)14/h1-2,4,13-14H,3H2
InChI key:InChIKey=AHBQIJFNXQLAIJ-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)C1=CC=C(B(O)O)C=N1
Synonyms:- Boronic acid, B-[6-(2,2,2-trifluoroethyl)-3-pyridinyl]-
- B-[6-(2,2,2-Trifluoroethyl)-3-pyridinyl]boronic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
