
CAS 1356110-33-2
:Methyl 5-chloro-2-cyano-3-pyridinecarboxylate
Description:
Methyl 5-chloro-2-cyano-3-pyridinecarboxylate is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a chloro group at the 5-position and a cyano group at the 2-position contributes to its reactivity and potential applications in various chemical syntheses. The methyl ester functional group at the carboxylate position enhances its solubility in organic solvents, making it useful in synthetic chemistry. This compound may exhibit biological activity, which is often explored in pharmaceutical research. Its structure suggests potential for nucleophilic substitution reactions due to the electrophilic nature of the carbonyl carbon in the ester group. Additionally, the cyano group can participate in various chemical transformations, including nucleophilic addition and cycloaddition reactions. Overall, Methyl 5-chloro-2-cyano-3-pyridinecarboxylate is a versatile compound with applications in organic synthesis and medicinal chemistry, although specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.
Formula:C8H5ClN2O2
InChI:InChI=1S/C8H5ClN2O2/c1-13-8(12)6-2-5(9)4-11-7(6)3-10/h2,4H,1H3
InChI key:InChIKey=RIGMVFIYNYQKRH-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C(C#N)N=CC(Cl)=C1
Synonyms:- Methyl 5-chloro-2-cyano-3-pyridinecarboxylate
- 3-Pyridinecarboxylic acid, 5-chloro-2-cyano-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
