CymitQuimica logo

CAS 1356110-50-3

:

5-(4-Fluorophenyl)-3-pyridinecarboxamide

Description:
5-(4-Fluorophenyl)-3-pyridinecarboxamide is an organic compound characterized by its structural features, which include a pyridine ring and a carboxamide functional group. The presence of a fluorophenyl group enhances its potential for biological activity, making it of interest in medicinal chemistry. This compound typically exhibits moderate to high solubility in organic solvents, while its solubility in water may vary depending on pH and temperature. The molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, the compound may display specific reactivity patterns due to the electron-withdrawing nature of the fluorine atom, influencing its chemical behavior in various reactions. Its stability under standard laboratory conditions is generally good, although it should be handled with care, as with all chemical substances, to avoid any adverse reactions. Overall, 5-(4-Fluorophenyl)-3-pyridinecarboxamide represents a valuable compound for further research in the fields of organic synthesis and pharmacology.
Formula:C12H9FN2O
InChI:InChI=1S/C12H9FN2O/c13-11-3-1-8(2-4-11)9-5-10(12(14)16)7-15-6-9/h1-7H,(H2,14,16)
InChI key:InChIKey=FNPVSJRVNBSKFQ-UHFFFAOYSA-N
SMILES:C(N)(=O)C1=CC(=CN=C1)C2=CC=C(F)C=C2
Synonyms:
  • 3-Pyridinecarboxamide, 5-(4-fluorophenyl)-
  • 5-(4-Fluorophenyl)-3-pyridinecarboxamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.