CAS 1356110-63-8
:5-(2-Chlorophenyl)-3-pyridinecarboxamide
Description:
5-(2-Chlorophenyl)-3-pyridinecarboxamide, identified by its CAS number 1356110-63-8, is a chemical compound characterized by its unique structural features, which include a pyridine ring and a chlorophenyl group. This compound typically exhibits properties associated with amides, such as moderate solubility in polar solvents and potential biological activity due to its ability to interact with various biological targets. The presence of the chlorophenyl moiety may impart specific electronic and steric effects, influencing its reactivity and interactions. Additionally, the pyridine ring contributes to the compound's aromaticity and can participate in hydrogen bonding, which may enhance its stability and solubility in certain environments. The compound's characteristics make it of interest in medicinal chemistry, particularly in the development of pharmaceuticals, where it may exhibit potential therapeutic effects. As with many organic compounds, its physical and chemical properties, such as melting point, boiling point, and reactivity, would need to be determined experimentally for precise applications.
Formula:C12H9ClN2O
InChI:InChI=1S/C12H9ClN2O/c13-11-4-2-1-3-10(11)8-5-9(12(14)16)7-15-6-8/h1-7H,(H2,14,16)
InChI key:InChIKey=BGLPGZXRUUYFRN-UHFFFAOYSA-N
SMILES:ClC1=C(C=2C=C(C(N)=O)C=NC2)C=CC=C1
Synonyms:- 3-Pyridinecarboxamide, 5-(2-chlorophenyl)-
- 5-(2-Chlorophenyl)-3-pyridinecarboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
