CAS 1356110-76-3
:5-(2-Methoxyphenyl)-3-pyridinecarboxamide
Description:
5-(2-Methoxyphenyl)-3-pyridinecarboxamide, identified by its CAS number 1356110-76-3, is a chemical compound that features a pyridine ring substituted with a carboxamide group and a methoxyphenyl moiety. This compound typically exhibits characteristics common to amides, such as moderate solubility in polar solvents due to the presence of the carboxamide functional group, which can engage in hydrogen bonding. The methoxy group contributes to its lipophilicity, potentially influencing its biological activity and interaction with various receptors or enzymes. The presence of the pyridine ring may also impart aromatic stability and contribute to the compound's electronic properties. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential biological activities. Its specific reactivity and interactions would depend on the functional groups present and the overall molecular structure, which can influence its pharmacokinetics and pharmacodynamics.
Formula:C13H12N2O2
InChI:InChI=1S/C13H12N2O2/c1-17-12-5-3-2-4-11(12)9-6-10(13(14)16)8-15-7-9/h2-8H,1H3,(H2,14,16)
InChI key:InChIKey=UGDGBVCXGWNRHX-UHFFFAOYSA-N
SMILES:O(C)C1=C(C=2C=C(C(N)=O)C=NC2)C=CC=C1
Synonyms:- 5-(2-Methoxyphenyl)-3-pyridinecarboxamide
- 3-Pyridinecarboxamide, 5-(2-methoxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
