CymitQuimica logo

CAS 1356110-84-3

:

5-(3-Methoxyphenyl)-3-pyridinecarboxamide

Description:
5-(3-Methoxyphenyl)-3-pyridinecarboxamide, identified by its CAS number 1356110-84-3, is a chemical compound characterized by its unique structural features. It consists of a pyridine ring substituted with a carboxamide group and a 3-methoxyphenyl moiety. The presence of the methoxy group enhances its lipophilicity and may influence its biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its molecular structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry and drug development. The compound may also display specific pharmacological properties, which could be explored in various therapeutic contexts. Additionally, its synthesis and characterization would involve standard organic chemistry techniques, including purification methods such as recrystallization or chromatography. Overall, 5-(3-Methoxyphenyl)-3-pyridinecarboxamide represents a class of compounds that could have significant implications in pharmaceutical research.
Formula:C13H12N2O2
InChI:InChI=1S/C13H12N2O2/c1-17-12-4-2-3-9(6-12)10-5-11(13(14)16)8-15-7-10/h2-8H,1H3,(H2,14,16)
InChI key:InChIKey=OQCIFMLYXMQHEM-UHFFFAOYSA-N
SMILES:C(N)(=O)C1=CC(=CN=C1)C2=CC(OC)=CC=C2
Synonyms:
  • 5-(3-Methoxyphenyl)-3-pyridinecarboxamide
  • 3-Pyridinecarboxamide, 5-(3-methoxyphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.