CAS 1356111-05-1
:5-[3-(Trifluoromethyl)phenyl]-3-pyridinecarboxamide
Description:
5-[3-(Trifluoromethyl)phenyl]-3-pyridinecarboxamide, identified by its CAS number 1356111-05-1, is a chemical compound characterized by its unique structural features, which include a pyridine ring and a trifluoromethyl-substituted phenyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential for diverse reactivity due to the presence of the carboxamide functional group. The trifluoromethyl group enhances lipophilicity and can influence the compound's biological activity, making it of interest in medicinal chemistry. Additionally, the presence of the pyridine moiety may contribute to its ability to form hydrogen bonds, affecting solubility and interaction with biological targets. Overall, this compound's characteristics suggest potential applications in pharmaceuticals or agrochemicals, although specific biological or chemical activity would require further investigation through experimental studies.
Formula:C13H9F3N2O
InChI:InChI=1S/C13H9F3N2O/c14-13(15,16)11-3-1-2-8(5-11)9-4-10(12(17)19)7-18-6-9/h1-7H,(H2,17,19)
InChI key:InChIKey=XYGFYPVSUGXLAN-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C=C(C=CC1)C=2C=C(C(N)=O)C=NC2
Synonyms:- 5-[3-(Trifluoromethyl)phenyl]-3-pyridinecarboxamide
- 3-Pyridinecarboxamide, 5-[3-(trifluoromethyl)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
