
CAS 1356111-22-2
:1,1-Dimethylethyl N-7-benzoxazolylcarbamate
Description:
1,1-Dimethylethyl N-7-benzoxazolylcarbamate, identified by its CAS number 1356111-22-2, is a chemical compound that belongs to the class of carbamates. This substance features a unique structure that includes a benzoxazole moiety, which contributes to its potential biological activity. Typically, compounds of this nature exhibit properties such as moderate to high stability under standard conditions, and they may possess specific solubility characteristics depending on the solvent used. The presence of the dimethyl group suggests steric hindrance, which can influence the compound's reactivity and interaction with biological targets. Additionally, the benzoxazole ring may impart fluorescence or other electronic properties, making it of interest in various applications, including pharmaceuticals and agrochemicals. As with many carbamates, it may also exhibit herbicidal or insecticidal properties, although specific biological activities would require empirical investigation. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or environmental impact.
Formula:C12H14N2O3
InChI:InChI=1S/C12H14N2O3/c1-12(2,3)17-11(15)14-9-6-4-5-8-10(9)16-7-13-8/h4-7H,1-3H3,(H,14,15)
InChI key:InChIKey=SRPAQSHICVRAKA-UHFFFAOYSA-N
SMILES:N(C(OC(C)(C)C)=O)C1=C2C(N=CO2)=CC=C1
Synonyms:- 1,1-Dimethylethyl N-7-benzoxazolylcarbamate
- Carbamic acid, N-7-benzoxazolyl-, 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
