CAS 1356111-30-2
:Ethyl 2-(hydroxymethyl)-4-pyrimidinecarboxylate
Description:
Ethyl 2-(hydroxymethyl)-4-pyrimidinecarboxylate is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered heterocyclic aromatic ring containing two nitrogen atoms at positions 1 and 3. This compound features an ethyl ester functional group, contributing to its solubility in organic solvents. The presence of a hydroxymethyl group at the 2-position of the pyrimidine ring enhances its reactivity and potential for further chemical modifications. Ethyl 2-(hydroxymethyl)-4-pyrimidinecarboxylate is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its properties, such as melting point, boiling point, and solubility, can vary based on environmental conditions and purity. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken. Overall, this compound exemplifies the diverse chemistry associated with pyrimidine derivatives, which are significant in various biological and chemical applications.
Formula:C8H10N2O3
InChI:InChI=1S/C8H10N2O3/c1-2-13-8(12)6-3-4-9-7(5-11)10-6/h3-4,11H,2,5H2,1H3
InChI key:InChIKey=NUXNOUAPVRCHJK-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=NC(CO)=NC=C1
Synonyms:- Ethyl 2-(hydroxymethyl)-4-pyrimidinecarboxylate
- 4-Pyrimidinecarboxylic acid, 2-(hydroxymethyl)-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
