CAS 1356111-36-8
:2-[(Phenylmethoxy)methyl]-4-pyrimidinecarboxylic acid
Description:
2-[(Phenylmethoxy)methyl]-4-pyrimidinecarboxylic acid, with the CAS number 1356111-36-8, is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered heterocyclic compound containing nitrogen atoms. This substance features a carboxylic acid functional group, contributing to its acidity and potential reactivity. The presence of the phenylmethoxy group indicates that it has an aromatic character, which can influence its solubility and interaction with biological systems. The compound may exhibit specific pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in targeting specific biological pathways. Additionally, the compound's stability, solubility in various solvents, and reactivity with other chemical agents would be important characteristics to consider in practical applications. Overall, this compound represents a unique combination of functional groups that may confer distinct chemical and biological properties.
Formula:C13H12N2O3
InChI:InChI=1S/C13H12N2O3/c16-13(17)11-6-7-14-12(15-11)9-18-8-10-4-2-1-3-5-10/h1-7H,8-9H2,(H,16,17)
InChI key:InChIKey=MQKMKKNIHHAUBJ-UHFFFAOYSA-N
SMILES:C(OCC1=CC=CC=C1)C=2N=C(C(O)=O)C=CN2
Synonyms:- 4-Pyrimidinecarboxylic acid, 2-[(phenylmethoxy)methyl]-
- 2-[(Phenylmethoxy)methyl]-4-pyrimidinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
