CAS 1356114-17-4
:4-Bromo-3-fluoro-5-methylbenzenesulfonyl chloride
Description:
4-Bromo-3-fluoro-5-methylbenzenesulfonyl chloride is an organic compound characterized by the presence of a sulfonyl chloride functional group attached to a substituted aromatic ring. The compound features a bromine atom and a fluorine atom as substituents on the benzene ring, along with a methyl group, which influences its reactivity and physical properties. It is typically a colorless to pale yellow liquid or solid, depending on the specific conditions and purity. The sulfonyl chloride group makes it a potent electrophile, allowing it to participate in various chemical reactions, including nucleophilic substitutions. This compound is often used in organic synthesis, particularly in the preparation of sulfonamides and other sulfonyl-containing compounds. Due to the presence of halogens and the sulfonyl chloride group, it may exhibit moderate to high toxicity and should be handled with appropriate safety precautions. Its reactivity and functional groups make it valuable in medicinal chemistry and materials science for developing new compounds.
Formula:C7H5BrClFO2S
InChI:InChI=1S/C7H5BrClFO2S/c1-4-2-5(13(9,11)12)3-6(10)7(4)8/h2-3H,1H3
InChI key:InChIKey=VBOASXBUXCVBFH-UHFFFAOYSA-N
SMILES:S(Cl)(=O)(=O)C1=CC(C)=C(Br)C(F)=C1
Synonyms:- 4-Bromo-3-fluoro-5-methylbenzenesulfonyl chloride
- Benzenesulfonyl chloride, 4-bromo-3-fluoro-5-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
