CAS 1356114-60-7
:1-(2-Propen-1-yl)-3-[3-(triethoxysilyl)propyl]benzene
Description:
1-(2-Propen-1-yl)-3-[3-(triethoxysilyl)propyl]benzene, identified by its CAS number 1356114-60-7, is an organosilicon compound characterized by the presence of both a vinyl group and a triethoxysilyl moiety. This compound features a benzene ring substituted with a propenyl group at one position and a propyl chain that is further substituted with three ethoxy groups at another position. The presence of the triethoxysilyl group enhances its reactivity, particularly in silane coupling reactions, making it useful in various applications such as surface modification, adhesion promotion, and as a coupling agent in composite materials. The vinyl group allows for further polymerization or cross-linking reactions, which can be advantageous in the development of advanced materials. Additionally, the compound's silane functionality provides compatibility with inorganic substrates, improving the bonding of organic materials to surfaces like glass, metals, and ceramics. Overall, this compound is significant in materials science and engineering, particularly in the fields of coatings, adhesives, and sealants.
Formula:C18H30O3Si
InChI:InChI=1S/C18H30O3Si/c1-5-11-17-12-9-13-18(16-17)14-10-15-22(19-6-2,20-7-3)21-8-4/h5,9,12-13,16H,1,6-8,10-11,14-15H2,2-4H3
InChI key:InChIKey=AWGHSOCGGKXGTG-UHFFFAOYSA-N
SMILES:[Si](CCCC1=CC(CC=C)=CC=C1)(OCC)(OCC)OCC
Synonyms:- 1-(2-Propen-1-yl)-3-[3-(triethoxysilyl)propyl]benzene
- Benzene, 1-(2-propen-1-yl)-3-[3-(triethoxysilyl)propyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.