CymitQuimica logo

CAS 1356165-84-8

:

3,4-Dihydro-6-iodo-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-pyrano[3,2-b]pyridine

Description:
3,4-Dihydro-6-iodo-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-pyrano[3,2-b]pyridine is a complex organic compound characterized by its unique structural features, including a pyrano[3,2-b]pyridine core, which contributes to its potential biological activity. The presence of the iodine atom enhances its reactivity and may influence its pharmacological properties. The incorporation of the boron-containing moiety, specifically the tetramethyl-1,3,2-dioxaborolane, suggests potential applications in medicinal chemistry, particularly in drug design and development, as boron compounds are often involved in various chemical transformations and biological interactions. This compound may exhibit interesting properties such as fluorescence or catalytic activity, depending on its specific interactions with other molecules. Its synthesis and characterization would typically involve advanced organic chemistry techniques, and its stability, solubility, and reactivity would be critical factors in determining its practical applications in research and industry. Overall, this compound represents a valuable target for further investigation in the fields of organic synthesis and medicinal chemistry.
Formula:C14H19BINO3
InChI:InChI=1S/C14H19BINO3/c1-13(2)14(3,4)20-15(19-13)9-8-11(16)17-10-6-5-7-18-12(9)10/h8H,5-7H2,1-4H3
InChI key:InChIKey=NGGKXBHWLFHPBI-UHFFFAOYSA-N
SMILES:IC1=CC(=C2C(=N1)CCCO2)B3OC(C)(C)C(C)(C)O3
Synonyms:
  • 2H-Pyrano[3,2-b]pyridine, 3,4-dihydro-6-iodo-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
  • 3,4-Dihydro-6-iodo-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-pyrano[3,2-b]pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.