
CAS 13562-46-4
:1-(2-Hydrazinylethyl)-4-methylpiperazine
Description:
1-(2-Hydrazinylethyl)-4-methylpiperazine, with the CAS number 13562-46-4, is an organic compound characterized by its piperazine structure, which includes a hydrazine functional group. This compound features a piperazine ring substituted with a methyl group at the 4-position and a hydrazinyl group at the 1-position, contributing to its unique reactivity and potential biological activity. It is typically a colorless to pale yellow liquid or solid, depending on its form and purity. The presence of the hydrazine moiety suggests that it may exhibit properties such as reducing ability and potential for forming coordination complexes with metals. Additionally, compounds containing hydrazine derivatives are often investigated for their pharmacological properties, including potential use in medicinal chemistry. However, due to the presence of hydrazine, which is known to be toxic and potentially carcinogenic, handling this substance requires caution and adherence to safety protocols. Its applications may extend to research in organic synthesis, pharmaceuticals, and possibly as a precursor for other chemical transformations.
Formula:C7H18N4
InChI:InChI=1S/C7H18N4/c1-10-4-6-11(7-5-10)3-2-9-8/h9H,2-8H2,1H3
InChI key:InChIKey=YEOVCYPFIOCZIG-UHFFFAOYSA-N
SMILES:C(CNN)N1CCN(C)CC1
Synonyms:- 1-(2-Hydrazino-ethyl)-4-methyl-piperazine
- Piperazine, 1-(2-hydrazinoethyl)-4-methyl-
- 1-(2-Hydrazinylethyl)-4-methylpiperazine
- Piperazine, 1-(2-hydrazinylethyl)-4-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.