CAS 13563-04-7
:2-Hydroxy-N-2-pyridinylbenzamide
Description:
2-Hydroxy-N-2-pyridinylbenzamide, also known by its CAS number 13563-04-7, is a chemical compound characterized by its structural features, which include a hydroxyl group (-OH) and a pyridine ring attached to a benzamide moiety. This compound typically exhibits properties such as solubility in polar solvents due to the presence of the hydroxyl group, which can engage in hydrogen bonding. It may also display moderate lipophilicity due to the aromatic benzamide structure. The presence of the pyridine nitrogen can influence its reactivity and potential interactions with biological systems, making it of interest in medicinal chemistry. Additionally, this compound may exhibit various biological activities, including potential antimicrobial or anti-inflammatory properties, although specific activities would depend on further empirical studies. Its stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 2-Hydroxy-N-2-pyridinylbenzamide is a compound of interest in both synthetic and pharmaceutical chemistry contexts.
Formula:C12H10N2O2
InChI:InChI=1S/C12H10N2O2/c15-10-6-2-1-5-9(10)12(16)14-11-7-3-4-8-13-11/h1-8,15H,(H,13,14,16)
InChI key:InChIKey=RAEVIQJZJBWVCX-UHFFFAOYSA-N
SMILES:C(NC1=CC=CC=N1)(=O)C2=C(O)C=CC=C2
Synonyms:- 2-Hydroxy-N-2-pyridinylbenzamide
- Benzamide, 2-hydroxy-N-2-pyridinyl-
- N1-(2-pyridyl)-2-hydroxybenzamide
- Salicyl-2′-pyridylamide
- Salicylamide, N-2-pyridyl-
- 2-Hydroxy-N-(pyridin-2-yl)benzamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.