CymitQuimica logo

CAS 135634-19-4

:

7-(Iodomethyl)bicyclo[4.2.0]octa-1,3,5-triene

Description:
7-(Iodomethyl)bicyclo[4.2.0]octa-1,3,5-triene is a bicyclic organic compound characterized by its unique structure, which features a bicyclo[4.2.0] framework and a reactive iodomethyl group. This compound is notable for its conjugated diene system, which contributes to its potential reactivity in various chemical reactions, such as electrophilic additions and polymerizations. The presence of the iodine atom enhances its electrophilic character, making it a useful intermediate in organic synthesis. The bicyclic structure provides rigidity and can influence the compound's physical properties, such as boiling and melting points, as well as its solubility in different solvents. Additionally, the compound may exhibit interesting optical properties due to its conjugated system. As with many halogenated compounds, it is essential to handle it with care due to potential toxicity and environmental concerns. Overall, 7-(Iodomethyl)bicyclo[4.2.0]octa-1,3,5-triene is a valuable compound in synthetic organic chemistry, particularly in the development of more complex molecular architectures.
Formula:C9H9I
InChI:InChI=1S/C9H9I/c10-6-8-5-7-3-1-2-4-9(7)8/h1-4,8H,5-6H2
InChI key:InChIKey=MGIXHHGPONMWMN-UHFFFAOYSA-N
SMILES:C(I)C1C=2C(C1)=CC=CC2
Synonyms:
  • Bicyclo[4.2.0]octa-1,3,5-triene, 7-(iodomethyl)-
  • 7-(Iodomethyl)bicyclo[4.2.0]octa-1,3,5-triene
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.