CAS 1356383-19-1
:N-(N-Benzoyl-L-tyrosyl)-L-alanine-d5
Description:
N-(N-Benzoyl-L-tyrosyl)-L-alanine-d5 is a synthetic compound that belongs to the class of amino acid derivatives. It is characterized by the presence of a benzoyl group attached to the nitrogen of the L-tyrosine moiety, which is further linked to L-alanine. The "d5" designation indicates that this compound is a deuterated form, meaning that it contains five deuterium atoms, which are isotopes of hydrogen. This deuteration can enhance the compound's stability and alter its spectroscopic properties, making it useful in various analytical techniques, such as NMR spectroscopy. The compound is likely to exhibit properties typical of amino acids, including solubility in polar solvents and the ability to participate in hydrogen bonding. Its structural features may also influence its biological activity, potentially making it relevant in pharmaceutical research or as a biochemical probe. Overall, N-(N-Benzoyl-L-tyrosyl)-L-alanine-d5 serves as a valuable tool in both chemical synthesis and analytical applications.
Formula:C19H20N2O5
InChI:InChI=1S/C19H20N2O5/c1-12(19(25)26)20-18(24)16(11-13-7-9-15(22)10-8-13)21-17(23)14-5-3-2-4-6-14/h2-10,12,16,22H,11H2,1H3,(H,20,24)(H,21,23)(H,25,26)/t12-,16-/m0/s1/i2D,3D,4D,5D,6D
InChI key:InChIKey=PSRCBRUPIDLBSA-CFEBADSDSA-N
SMILES:[C@@H](CC1=CC=C(O)C=C1)(NC(=O)C2=C(C(=C(C(=C2[2H])[2H])[2H])[2H])[2H])C(N[C@H](C(O)=O)C)=O
Synonyms:- N-(N-Benzoyl-L-tyrosyl)-L-alanine-d5
- (2S)-2-[[(2S)-3-(4-Hydroxyphenyl)-2-[(2,3,4,5,6-pentadeuteriobenzoyl)amino]propanoyl]amino]propanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.