CAS 1356483-73-2

4-Amino-3-(cyclopropylamino)benzonitrile

Description:

4-Amino-3-(cyclopropylamino)benzonitrile is an organic compound characterized by its aromatic structure, which includes an amino group and a cyano group attached to a benzene ring. The presence of the cyclopropylamino substituent introduces a three-membered carbon ring, contributing to the compound's unique steric and electronic properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of functional groups that can participate in various chemical reactions. The amino and cyano groups can engage in hydrogen bonding and other interactions, influencing the compound's reactivity and biological activity. Additionally, the compound's specific characteristics, such as melting point, boiling point, and spectral properties, would be determined through experimental methods and may vary based on purity and environmental conditions. Overall, 4-Amino-3-(cyclopropylamino)benzonitrile represents a versatile scaffold for further chemical exploration and potential therapeutic applications.

Formula: C₁₀H₁₁N₃

InChI: InChI=1S/C10H11N3/c11-6-7-1-4-9(12)10(5-7)13-8-2-3-8/h1,4-5,8,13H,2-3,12H2

InChI key: InChIKey=ZMUDBYJHNYYBHM-UHFFFAOYSA-N

SMILES: N(C1=CC(C#N)=CC=C1N)C2CC2

Synonyms:

• Benzonitrile, 4-amino-3-(cyclopropylamino)-
• 4-Amino-3-(cyclopropylamino)benzonitrile