CAS 135651-46-6
:2-MORPHOLIN-4-YLMETHYLBENZOIC ACID METHYL ESTER
Description:
2-Morpholin-4-ylmethylbenzoic acid methyl ester, with the CAS number 135651-46-6, is a chemical compound characterized by its morpholine and benzoic acid moieties. This compound typically exhibits properties associated with both amine and carboxylic acid functionalities, which can influence its solubility and reactivity. It is likely to be a white to off-white solid at room temperature, with moderate solubility in polar organic solvents due to the presence of the morpholine ring. The methyl ester group suggests that it may undergo hydrolysis to release the corresponding benzoic acid, which can be relevant in various chemical reactions. Additionally, the morpholine ring can participate in hydrogen bonding, enhancing its interactions with other molecules. This compound may find applications in pharmaceuticals or as an intermediate in organic synthesis, owing to its structural features that allow for further functionalization. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C13H17NO3
InChI:InChI=1/C13H17NO3/c1-16-13(15)12-5-3-2-4-11(12)10-14-6-8-17-9-7-14/h2-5H,6-10H2,1H3
SMILES:COC(=O)c1ccccc1CN1CCOCC1
Synonyms:- 2-Morpholin-4-Ylmethylbenzoic Acid Methyl Ester, 95+%
- Methyl 2-(Morpholinomethyl)Benzoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
