CAS 1356543-25-3

1H-Pyrazolo[3,4-b]pyridine-3-carboxylic acid, 4-[3-(acetylamino)phenyl]-1-methyl-

Description:

1H-Pyrazolo[3,4-b]pyridine-3-carboxylic acid, 4-[3-(acetylamino)phenyl]-1-methyl- is a chemical compound characterized by its complex structure, which includes a pyrazolo[3,4-b]pyridine core fused with a carboxylic acid and an acetylamino-substituted phenyl group. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity, making it of interest in medicinal chemistry. The presence of the carboxylic acid functional group suggests it may engage in hydrogen bonding and participate in acid-base reactions. Additionally, the acetylamino group can enhance solubility and influence the compound's interaction with biological targets. The methyl group on the pyrazole ring may affect the compound's steric properties and overall reactivity. Overall, this compound's unique structural features may contribute to its potential applications in pharmaceuticals, particularly in the development of new therapeutic agents. Further studies would be necessary to elucidate its specific properties and biological activities.

Formula: C₁₆H₁₄N₄O₃

InChI: InChI=1S/C16H14N4O3/c1-9(21)18-11-5-3-4-10(8-11)12-6-7-17-15-13(12)14(16(22)23)19-20(15)2/h3-8H,1-2H3,(H,18,21)(H,22,23)

InChI key: InChIKey=WESCJAVMWYMWGH-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C2=C(C=CN=C2N(C)N1)C3=CC(NC(C)=O)=CC=C3

Synonyms:

• 1H-Pyrazolo[3,4-b]pyridine-3-carboxylic acid, 4-[3-(acetylamino)phenyl]-1-methyl-
• 4-(3-Acetylamino-phenyl)-1-methyl-1H-pyrazolo[3,4-b]pyridine-3-carboxylic acid
• 4-[3-(Acetylamino)phenyl]-1-methylpyrazolo[5,4-b]pyridine-3-carboxylic acid