CAS 1356543-59-3
:4-[4-(Acetylamino)phenyl]-1-methyl-1H-pyrazolo[3,4-b]pyridine-3-carboxylic acid
Description:
4-[4-(Acetylamino)phenyl]-1-methyl-1H-pyrazolo[3,4-b]pyridine-3-carboxylic acid is a chemical compound characterized by its complex structure, which includes a pyrazolo-pyridine core and an acetylamino substituent. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to its ability to interact with various biological targets. The presence of the carboxylic acid functional group suggests it may exhibit acidic properties, influencing its solubility and reactivity in different environments. Additionally, the acetylamino group can enhance its pharmacological profile, potentially affecting its binding affinity and selectivity towards specific receptors or enzymes. The compound's molecular structure may also confer stability and influence its metabolic pathways. Overall, this substance may be of interest in medicinal chemistry, particularly in the development of therapeutic agents, due to its unique structural features and potential bioactivity. Further studies would be necessary to fully elucidate its properties and applications in various fields.
Formula:C16H14N4O3
InChI:InChI=1S/C16H14N4O3/c1-9(21)18-11-5-3-10(4-6-11)12-7-8-17-15-13(12)14(16(22)23)19-20(15)2/h3-8H,1-2H3,(H,18,21)(H,22,23)
InChI key:InChIKey=VGZBUIGSMSQISZ-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C2=C(C=CN=C2N(C)N1)C3=CC=C(NC(C)=O)C=C3
Synonyms:- 1H-Pyrazolo[3,4-b]pyridine-3-carboxylic acid, 4-[4-(acetylamino)phenyl]-1-methyl-
- 4-[4-(Acetylamino)phenyl]-1-methyl-1H-pyrazolo[3,4-b]pyridine-3-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.