
CAS 135668-77-8
:1-Naphthalenesulfonic acid, 3-diazo-3,4-dihydro-4-oxo-, ester with 4,4′-[1-[4-[1-(4-hydroxyphenyl)-1-methylethyl]phenyl]ethylidene]bis[phenol]
Description:
1-Naphthalenesulfonic acid, 3-diazo-3,4-dihydro-4-oxo-, ester with 4,4′-[1-[4-[1-(4-hydroxyphenyl)-1-methylethyl]phenyl]ethylidene]bis[phenol] is a complex organic compound characterized by its sulfonic acid and diazo functional groups, which contribute to its reactivity and potential applications in dye chemistry and as a coupling agent. The presence of multiple aromatic rings in its structure enhances its stability and hydrophobic properties, making it suitable for various industrial applications, including as a dye intermediate or in polymer chemistry. The compound's ester functionality suggests it may exhibit moderate solubility in organic solvents, while the hydroxyl groups can engage in hydrogen bonding, influencing its solubility in polar solvents. Additionally, the presence of the diazo group indicates potential for azo coupling reactions, which are significant in the synthesis of azo dyes. Overall, this compound's unique structural features and functional groups make it a valuable substance in chemical synthesis and materials science.
Formula:C29H28O3·xC10H6N2O4S
InChI:InChI=1S/C29H28O3.C10H6N2O4S/c1-28(2,21-8-14-25(30)15-9-21)20-4-6-22(7-5-20)29(3,23-10-16-26(31)17-11-23)24-12-18-27(32)19-13-24;11-12-8-5-9(17(14,15)16)6-3-1-2-4-7(6)10(8)13/h4-19,30-32H,1-3H3;1-5H,(H,14,15,16)
InChI key:InChIKey=BQZVPAUYUMFJHB-UHFFFAOYSA-N
SMILES:C(C)(C1=CC=C(C(C)(C)C2=CC=C(O)C=C2)C=C1)(C3=CC=C(O)C=C3)C4=CC=C(O)C=C4.S(=O)(=O)(O)C=1C=2C(C(=O)C(=[N+]=[N-])C1)=CC=CC2
Synonyms:- 1,1-Bis(4-hydroxyphenyl)-1-[4-(1-(4-hydroxyphenyl)-1-methylethyl)phenyl]ethane 1,2-naphthoquinonediazide-4-sulfonic acid ester
- 2-[4-[1,1-Bis(4-hydroxyphenyl)ethyl]phenyl]-2-(4-hydroxyphenyl)propane 1,2-naphthoquinonediazide-4-sulfonate
- 1-Naphthalenesulfonic acid, 3-diazo-3,4-dihydro-4-oxo-, ester with 4,4′-[1-[4-[1-(4-hydroxyphenyl)-1-methylethyl]phenyl]ethylidene]bis[phenol]
- Trisphenol PA 1,2-naphthoquinonediazide-4-sulfonate
- 1,1-Bis(4-hydroxyphenyl)-4-[1-(4-hydroxyphenyl)-1-methylethyl]-1-phenylethane 1,2-naphthoquinonediazido-4-sulfonate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.