CymitQuimica logo

CAS 1356823-19-2

:

(T-4)-[N-[(Carboxy-κO)methyl]-N-methylglycinato(2-)-κN,κO]-2-naphthalenylboron

Description:
The chemical substance known as "(T-4)-[N-[(Carboxy-κO)methyl]-N-methylglycinato(2-)-κN,κO]-2-naphthalenylboron" with CAS number 1356823-19-2 is a boron-containing compound that features a complex structure involving a naphthalene moiety and a modified amino acid derivative. Its characteristics include the presence of a carboxymethyl group, which contributes to its potential solubility in polar solvents and may enhance its reactivity. The compound's boron atom is typically involved in coordination chemistry, potentially allowing it to form complexes with various ligands. This substance may exhibit unique optical properties due to the naphthalene component, which is known for its aromaticity and ability to participate in π-π stacking interactions. Additionally, the presence of functional groups such as carboxyl and methyl groups suggests potential applications in biological systems, possibly as a ligand in drug design or as a probe in biochemical assays. Overall, the compound's intricate structure and functional groups indicate a versatile chemical behavior that could be explored in various scientific fields.
Formula:C15H14BNO4
InChI:InChI=1S/C15H14BNO4/c1-17-9-14(18)20-16(17,21-15(19)10-17)13-7-6-11-4-2-3-5-12(11)8-13/h2-8H,9-10H2,1H3
InChI key:InChIKey=SLKUVWKDCFWKGH-UHFFFAOYSA-N
SMILES:C[N]12[B+3]([O-]C(=O)C1)([O-]C(=O)C2)[C-]3=CC4=C(C=C3)C=CC=C4
Synonyms:
  • Boron, [N-[(carboxy-κO)methyl]-N-methylglycinato(2-)-κN,κO]-2-naphthalenyl-, (T-4)-
  • (T-4)-[N-[(Carboxy-κO)methyl]-N-methylglycinato(2-)-κN,κO]-2-naphthalenylboron
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.