
CAS 1356848-49-1
:Acetamide, N-[(3S,4R,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-piperidinyl]-, hydrochloride (1:1)
Description:
Acetamide, N-[(3S,4R,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-piperidinyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine structure, which includes multiple hydroxyl groups that contribute to its solubility and reactivity. The presence of the acetamide functional group indicates that it can participate in various chemical reactions typical of amides, such as hydrolysis and acylation. The specific stereochemistry denoted by the (3S,4R,5R,6R) configuration suggests that the compound has distinct spatial arrangements that may influence its biological activity and interactions with other molecules. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions, making it suitable for pharmaceutical applications. This compound may exhibit properties such as being a potential intermediate in drug synthesis or having specific biological activities, although detailed studies would be necessary to elucidate its full profile. Overall, its unique structural features and functional groups make it a compound of interest in medicinal chemistry and related fields.
Formula:C8H16N2O4·ClH
InChI:InChI=1S/C8H16N2O4.ClH/c1-4(12)10-5-2-9-6(3-11)8(14)7(5)13;/h5-9,11,13-14H,2-3H2,1H3,(H,10,12);1H/t5-,6+,7+,8+;/m0./s1
InChI key:InChIKey=PXYTXXMWBPXVRV-ANJNCBFHSA-N
SMILES:N(C(C)=O)[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)NC1.Cl
Synonyms:- Acetamide, N-[(3S,4R,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-piperidinyl]-, hydrochloride (1:1)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2-Acetamido-1,2-dideoxynojirimycin hydrochloride
CAS:Formula:C8H17ClN2O4Purity:≥ 97.0%Color and Shape:White to pale beige or pale brown powderMolecular weight:204.222-Acetamido-1,2-dideoxynojirimycin Hydrochloride
CAS:Controlled ProductFormula:C8H17ClN2O4Color and Shape:NeatMolecular weight:240.682-Acetamido-1,2-dideoxynojirimycin hydrochloride
CAS:2-Acetamido-1,2-dideoxynojirimycin hydrochloride is used in the treatment of human ovarian carcinoma. It has been shown to inhibit glycosidase enzymes with binding constants in the micromolar range. 2-Acetamido-1,2-dideoxynojirimycin hydrochloride has been shown to be a potential inhibitor of mammalian cell transport involving complex oligosaccharides. This drug also inhibits the enzymatic degradation of glycoproteins and other proteins by glycosidases. 2-Acetamido-1,2-dideoxynojirimycin hydrochloride is a synthetic analog of nijirimycin, which is a naturally occurring antibiotic obtained from cultures of Streptomyces nijirimensis. The clinical significance of this drug is that it can be used as an antiangiogenic agent and chemo sensitizingFormula:C8H16N2O4·HClPurity:(%) Min. 97%Color and Shape:White PowderMolecular weight:204.22 g/mol



