CAS 135689-23-5
:2,6-dibutyl-5-{[2'-(2H-tetrazol-5-yl)biphenyl-4-yl]methyl}pyrimidin-4(1H)-one
Description:
2,6-Dibutyl-5-{[2'-(2H-tetrazol-5-yl)biphenyl-4-yl]methyl}pyrimidin-4(1H)-one, with the CAS number 135689-23-5, is a complex organic compound characterized by its unique structural features, including a pyrimidinone core, multiple butyl substituents, and a biphenyl moiety linked to a tetrazole group. This compound exhibits a range of chemical properties due to the presence of various functional groups, which can influence its solubility, reactivity, and potential biological activity. The tetrazole ring is known for its ability to form hydrogen bonds and participate in coordination chemistry, while the biphenyl structure may contribute to its electronic properties. The presence of butyl groups enhances hydrophobic interactions, potentially affecting the compound's behavior in biological systems. Overall, this substance may have applications in medicinal chemistry or materials science, although specific data regarding its biological activity or practical applications would require further investigation.
Formula:C26H30N6O
InChI:InChI=1/C26H30N6O/c1-3-5-11-23-22(26(33)28-24(27-23)12-6-4-2)17-18-13-15-19(16-14-18)20-9-7-8-10-21(20)25-29-31-32-30-25/h7-10,13-16H,3-6,11-12,17H2,1-2H3,(H,27,28,33)(H,29,30,31,32)
SMILES:CCCCc1c(Cc2ccc(cc2)c2ccccc2c2n[nH]nn2)c(nc(CCCC)n1)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
CGP 48369
CAS:CGP 48369 is a calcium antagonist that has been shown to lower blood pressure in patients with cirrhosis and congestive heart failure. It also exhibits an anti-angiotensin effect, which may contribute to its ability to increase the release of nitric oxide. CGP 48369 inhibits the enzyme that converts angiotensin I into angiotensin II, thereby blocking the effects of this hormone on the kidneys, blood vessels, and heart. CGP 48369 is not metabolized by cytochrome P450 enzymes and is excreted unchanged in urine. The drug binds to vitamin B12 and retinoic acid, which may contribute to its negative effects on red blood cells.Formula:C26H30N6OPurity:Min. 95%Molecular weight:442.6 g/molCGP48369
CAS:CGP48369 is a potent angiotensin II receptor antagonist with antihypertensive effects that enhances endothelium-dependent relaxation of coronary arteries inFormula:C26H30N6OPurity:99.27%Color and Shape:SolidMolecular weight:442.56


