CAS 13569-97-6

4-(1H-IMIDAZOL-4-YL)BENZOIC ACID

Description:

4-(1H-Imidazol-4-yl)benzoic acid, with the CAS number 13569-97-6, is an organic compound characterized by the presence of both an imidazole and a carboxylic acid functional group. This compound features a benzoic acid moiety, where a 1H-imidazole ring is substituted at the para position. It is typically a white to off-white solid that is soluble in polar solvents such as water and alcohols, owing to the presence of the carboxylic acid group. The imidazole ring contributes to its potential biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting various biological pathways. The compound may exhibit properties such as antimicrobial or antifungal activity, and its derivatives are often explored for their roles in coordination chemistry and as ligands in metal complexes. Additionally, it can participate in various chemical reactions, including esterification and amidation, making it a versatile building block in organic synthesis.

Formula: C₁₀H₈N₂O₂

InChI: InChI=1/C10H8N2O2/c13-10(14)8-3-1-7(2-4-8)9-5-11-6-12-9/h1-6H,(H,11,12)(H,13,14)

SMILES: c1cc(ccc1c1cnc[nH]1)C(=O)O

Synonyms:

• 4-(1H-Imidazol-4-yl)benzoic acid 95%
• 4-(1H-Imidazol-5-yl)benzoic acid

4-(1H-Imidazol-4-yl)benzoic acid

CAS: 13569-97-6

Formula: C₁₀H₈N₂O₂

Purity: 95%

Molecular weight: 188.1827

Ref: IN-DA0072JC

4-(1H-Imidazol-4-yl)benzoic acid

CAS: 13569-97-6

4-(1H-Imidazol-4-yl)benzoic acid

Formula: C₁₀H₈N₂O₂

Purity: 97%

Color and Shape: Off-White To Pale Green Powder

Molecular weight: 188.18g/mol

Ref: 54-OR6239

4-(1H-Imidazol-4-yl)benzoic Acid

CAS: 13569-97-6

Formula: C₁₀H₈N₂O₂

Purity: 95.0%

Molecular weight: 188.186

Ref: 10-F065841

4-(1H-Imidazol-4-yl)benzoic acid

CAS: 13569-97-6

4-(1H-Imidazol-4-yl)benzoic acid is a white crystalline solid that is soluble in water. It is a coordination compound with two carboxylate functional groups and two imidazolyl ligands in the form of linear chains. The temperature of the reaction determines whether copper or nickel will be used as the metal ion. With copper, 4-(1H-imidazol-4-yl)benzoic acid forms a mononuclear complex, whereas with nickel it forms a bidentate complex. This chemical has been shown to have antimicrobial activity against bacteria and fungi, including methicillin resistant Staphylococcus aureus (MRSA).

Formula: C₁₀H₈N₂O₂

Purity: Min. 95%

Molecular weight: 188.18 g/mol

Ref: 3D-NAA56997