
CAS 1356953-69-9
:1-(1-Methyl-3-pyrrolidinyl)-1H-pyrazol-4-amine
Description:
1-(1-Methyl-3-pyrrolidinyl)-1H-pyrazol-4-amine, identified by its CAS number 1356953-69-9, is a chemical compound that features a pyrazole ring substituted with an amine group and a pyrrolidine moiety. This compound is characterized by its potential biological activity, often explored in medicinal chemistry for its pharmacological properties. The presence of the pyrrolidine ring contributes to its structural complexity and may influence its interaction with biological targets. Typically, compounds of this nature are evaluated for their solubility, stability, and reactivity, which are crucial for understanding their behavior in biological systems. Additionally, the compound may exhibit specific functional groups that can participate in hydrogen bonding or other intermolecular interactions, affecting its efficacy and safety profile. As with many synthetic organic compounds, its synthesis, characterization, and potential applications in drug development are of significant interest in the field of pharmaceutical chemistry.
Formula:C8H14N4
InChI:InChI=1S/C8H14N4/c1-11-3-2-8(6-11)12-5-7(9)4-10-12/h4-5,8H,2-3,6,9H2,1H3
InChI key:InChIKey=QQDVZDGMTMHVPZ-UHFFFAOYSA-N
SMILES:CN1CC(CC1)N2C=C(N)C=N2
Synonyms:- 1-(1-Methylpyrrolidin-3-yl)-1H-pyrazol-4-amine
- 1H-Pyrazol-4-amine, 1-(1-methyl-3-pyrrolidinyl)-
- 1-(1-Methyl-3-pyrrolidinyl)-1H-pyrazol-4-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.