CAS 1356954-04-5

1,1-Dimethylethyl N-[1-(5-amino-2-pyridinyl)-3-piperidinyl]carbamate

Description:

1,1-Dimethylethyl N-[1-(5-amino-2-pyridinyl)-3-piperidinyl]carbamate, identified by its CAS number 1356954-04-5, is a chemical compound characterized by its complex structure, which includes a carbamate functional group and a piperidine ring. This compound typically exhibits properties associated with both amines and carbamates, such as potential basicity and the ability to form hydrogen bonds. It may be soluble in polar solvents due to the presence of nitrogen atoms, which can engage in dipole-dipole interactions. The presence of the pyridine ring suggests that it may also exhibit aromatic characteristics, contributing to its stability and reactivity. This compound may be of interest in pharmaceutical research, particularly in the development of drugs targeting specific biological pathways, given its structural features that could interact with biological macromolecules. However, detailed information regarding its specific physical and chemical properties, such as melting point, boiling point, and reactivity, would require empirical data or literature references for precise characterization.

Formula: C₁₅H₂₄N₄O₂

InChI: InChI=1S/C15H24N4O2/c1-15(2,3)21-14(20)18-12-5-4-8-19(10-12)13-7-6-11(16)9-17-13/h6-7,9,12H,4-5,8,10,16H2,1-3H3,(H,18,20)

InChI key: InChIKey=NBTNDUBSJWWOMC-UHFFFAOYSA-N

SMILES: N(C(OC(C)(C)C)=O)C1CN(C2=CC=C(N)C=N2)CCC1

Synonyms:

• Carbamic acid, N-[1-(5-amino-2-pyridinyl)-3-piperidinyl]-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl N-[1-(5-amino-2-pyridinyl)-3-piperidinyl]carbamate