CymitQuimica logo

CAS 1357086-93-1

:

2,4-Dichloro-6-propyl-6H-pyrrolo[3,4-d]pyrimidine

Description:
2,4-Dichloro-6-propyl-6H-pyrrolo[3,4-d]pyrimidine is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both pyrrole and pyrimidine rings. This compound features two chlorine atoms at the 2 and 4 positions and a propyl group at the 6 position, contributing to its chemical reactivity and potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The presence of chlorine atoms often enhances the compound's lipophilicity, which can influence its behavior in biological systems. Additionally, the structural features suggest potential applications in pharmaceuticals or agrochemicals, as similar compounds are often investigated for their efficacy as herbicides or in medicinal chemistry. Safety and handling precautions should be observed, as halogenated compounds can pose environmental and health risks. Overall, 2,4-Dichloro-6-propyl-6H-pyrrolo[3,4-d]pyrimidine represents a class of compounds with diverse applications and significant interest in chemical research.
Formula:C9H9Cl2N3
InChI:InChI=1S/C9H9Cl2N3/c1-2-3-14-4-6-7(5-14)12-9(11)13-8(6)10/h4-5H,2-3H2,1H3
InChI key:InChIKey=XGKIUEPHNXERGX-UHFFFAOYSA-N
SMILES:ClC=1C=2C(=CN(CCC)C2)N=C(Cl)N1
Synonyms:
  • 6H-Pyrrolo[3,4-d]pyrimidine, 2,4-dichloro-6-propyl-
  • 2,4-Dichloro-6-propyl-6H-pyrrolo[3,4-d]pyrimidine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.