CymitQuimica logo

CAS 1357087-31-0

:

5,7-Dichloro-2-propyl-2H-pyrazolo[4,3-d]pyrimidine

Description:
5,7-Dichloro-2-propyl-2H-pyrazolo[4,3-d]pyrimidine is a heterocyclic compound characterized by its pyrazolo-pyrimidine structure, which incorporates both pyrazole and pyrimidine rings. This compound features two chlorine atoms at the 5 and 7 positions, contributing to its reactivity and potential biological activity. The presence of a propyl group at the 2 position enhances its lipophilicity, which may influence its pharmacokinetic properties. Typically, such compounds are of interest in medicinal chemistry due to their potential as bioactive agents, possibly exhibiting anti-inflammatory or anti-cancer properties. The molecular structure suggests that it may interact with various biological targets, making it a candidate for further research in drug development. Additionally, the compound's stability, solubility, and reactivity can be influenced by the substituents on the rings, which are critical for understanding its behavior in biological systems and potential applications in pharmaceuticals.
Formula:C8H8Cl2N4
InChI:InChI=1S/C8H8Cl2N4/c1-2-3-14-4-5-6(13-14)7(9)12-8(10)11-5/h4H,2-3H2,1H3
InChI key:InChIKey=ZOVVYMBBSYYSFC-UHFFFAOYSA-N
SMILES:ClC=1C=2C(=CN(CCC)N2)N=C(Cl)N1
Synonyms:
  • 2H-Pyrazolo[4,3-d]pyrimidine, 5,7-dichloro-2-propyl-
  • 5,7-Dichloro-2-propyl-2H-pyrazolo[4,3-d]pyrimidine
  • 5,7-Dichloro-2-ethyl-2H-pyrazolo[4,3-D]pyriMidine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.