CymitQuimica logo

CAS 135711-18-1

:

(R)-(-)-2-(2-ISOINDOLINYL)BUTAN-1-OL

Description:
(R)-(-)-2-(2-ISOINDOLINYL)BUTAN-1-OL is a chiral organic compound characterized by its specific stereochemistry, indicated by the (R) configuration. This compound features a butanol backbone with a hydroxyl (-OH) group, which contributes to its alcohol properties. The presence of the isoindoline moiety adds complexity to its structure, influencing its reactivity and potential interactions with biological systems. As a chiral molecule, it may exhibit different pharmacological activities compared to its enantiomer, making it of interest in medicinal chemistry and drug development. The compound's solubility, boiling point, and melting point can vary based on its molecular interactions and the presence of functional groups. Additionally, its stereochemistry can affect its binding affinity to biological targets, which is crucial for applications in pharmaceuticals. Overall, (R)-(-)-2-(2-ISOINDOLINYL)BUTAN-1-OL represents a significant compound in the study of chiral molecules and their applications in various fields, including organic synthesis and medicinal chemistry.
Formula:C12H19NO
InChI:InChI=1/C12H17NO/c1-2-12(9-14)13-7-10-5-3-4-6-11(10)8-13/h3-6,12,14H,2,7-9H2,1H3/p+1/t12-/m1/s1
Synonyms:
  • (R)-(-)-2-(1,3-Dihydro-Isoindol-2-Yl)Butan-1-Ol
  • (R)-(-)-2-(2-Iso-Indolinyl)Butan-1-Ol 97%
  • 2-[(1R)-1-(hydroxymethyl)propyl]-2,3-dihydro-1H-isoindolium
  • (R)-(-)-2-(2-ISOINDOLINYL)BUTAN-1-OL
  • (R)-(-)-2-(2-Isoindolinyl)butan-1-ol,97%
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.