CymitQuimica logo

CAS 1357147-39-7

:

1-(5-Bromo-1,3,4-thiadiazol-2-yl)hexahydro-1H-1,4-diazepine

Description:
1-(5-Bromo-1,3,4-thiadiazol-2-yl)hexahydro-1H-1,4-diazepine is a chemical compound characterized by its unique structure, which includes a hexahydro-1H-1,4-diazepine moiety fused with a 5-bromo-1,3,4-thiadiazole ring. This compound features a heterocyclic framework, incorporating both nitrogen and sulfur atoms, which contributes to its potential biological activity. The presence of the bromine atom enhances its reactivity and may influence its pharmacological properties. Typically, compounds of this nature are investigated for their potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. The thiadiazole ring is known for its diverse biological activities, including antimicrobial and anti-inflammatory properties. Additionally, the hexahydro-1H-1,4-diazepine structure may impart properties relevant to central nervous system activity. Overall, this compound represents a class of heterocyclic compounds that are of interest in drug discovery and development due to their complex structures and potential biological effects.
Formula:C7H11BrN4S
InChI:InChI=1S/C7H11BrN4S/c8-6-10-11-7(13-6)12-4-1-2-9-3-5-12/h9H,1-5H2
InChI key:InChIKey=OIMOFEIMUFTFCL-UHFFFAOYSA-N
SMILES:BrC=1SC(=NN1)N2CCCNCC2
Synonyms:
  • 1-(5-Bromo-1,3,4-thiadiazol-2-yl)hexahydro-1H-1,4-diazepine
  • 1H-1,4-Diazepine, 1-(5-bromo-1,3,4-thiadiazol-2-yl)hexahydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.