CymitQuimica logo

CAS 135722-25-7

:

4-Fluoro-N-[2-[4-(7-methoxy-1-naphthalenyl)-1-piperazinyl]ethyl]benzamide

Description:
4-Fluoro-N-[2-[4-(7-methoxy-1-naphthalenyl)-1-piperazinyl]ethyl]benzamide, with the CAS number 135722-25-7, is a chemical compound characterized by its complex structure, which includes a fluorine atom, a benzamide moiety, and a piperazine ring. This compound features a naphthalene derivative with a methoxy group, contributing to its potential biological activity. The presence of the fluorine atom often enhances the lipophilicity and metabolic stability of the molecule, which can influence its pharmacokinetic properties. The piperazine ring is commonly associated with various pharmacological activities, including antipsychotic and antidepressant effects. The overall structure suggests potential interactions with neurotransmitter systems, making it of interest in medicinal chemistry and drug development. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its properties can be further explored through various analytical methods such as NMR, mass spectrometry, and chromatography. As with many compounds of this nature, safety and handling precautions are essential due to potential biological activity.
Formula:C24H26FN3O2
InChI:InChI=1S/C24H26FN3O2/c1-30-21-10-7-18-3-2-4-23(22(18)17-21)28-15-13-27(14-16-28)12-11-26-24(29)19-5-8-20(25)9-6-19/h2-10,17H,11-16H2,1H3,(H,26,29)
InChI key:InChIKey=IFMQODYDAUKKEN-UHFFFAOYSA-N
SMILES:O(C)C1=CC=2C(=CC=CC2C=C1)N3CCN(CCNC(=O)C4=CC=C(F)C=C4)CC3
Synonyms:
  • 4-Fluoro-N-[2-[4-(7-methoxy-1-naphthalenyl)-1-piperazinyl]ethyl]benzamide
  • Benzamide, 4-fluoro-N-[2-[4-(7-methoxy-1-naphthalenyl)-1-piperazinyl]ethyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.