
CAS 135722-27-9
:N-[2-[4-(7-Methoxy-1-naphthalenyl)-1-piperazinyl]ethyl]-2-thiophenecarboxamide
Description:
N-[2-[4-(7-Methoxy-1-naphthalenyl)-1-piperazinyl]ethyl]-2-thiophenecarboxamide, with the CAS number 135722-27-9, is a chemical compound characterized by its complex structure, which includes a thiophene ring, a piperazine moiety, and a methoxy-substituted naphthalene. This compound typically exhibits properties associated with its functional groups, such as potential solubility in organic solvents and moderate polarity due to the presence of both hydrophobic and hydrophilic elements. The piperazine ring often contributes to biological activity, making this compound of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting various receptors. The methoxy group can enhance lipophilicity, potentially influencing the compound's pharmacokinetics and bioavailability. Additionally, the thiophene component may impart unique electronic properties, which can affect the compound's reactivity and interaction with biological targets. Overall, this compound's characteristics suggest it may have applications in drug development, particularly in areas related to neuropharmacology or other therapeutic fields.
Formula:C22H25N3O2S
InChI:InChI=1S/C22H25N3O2S/c1-27-18-8-7-17-4-2-5-20(19(17)16-18)25-13-11-24(12-14-25)10-9-23-22(26)21-6-3-15-28-21/h2-8,15-16H,9-14H2,1H3,(H,23,26)
InChI key:InChIKey=YFNZHCXOYLKDGU-UHFFFAOYSA-N
SMILES:O(C)C1=CC=2C(=CC=CC2C=C1)N3CCN(CCNC(=O)C4=CC=CS4)CC3
Synonyms:- S 14671
- 2-Thiophenecarboxamide, N-[2-[4-(7-methoxy-1-naphthalenyl)-1-piperazinyl]ethyl]-
- N-[2-[4-(7-Methoxy-1-naphthalenyl)-1-piperazinyl]ethyl]-2-thiophenecarboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
S-14671
CAS:S-14671: 5-HT1A agonist (pKi 9.3), potent in vivo; 5-HT2A/2C antagonist (pKi 7.8).Formula:C22H25N3O2SColor and Shape:SolidMolecular weight:395.52
