CymitQuimica logo

CAS 1357352-64-7

:

2-Piperidinemethanamine, N,N-dimethyl-, hydrochloride (1:1)

Description:
2-Piperidinemethanamine, N,N-dimethyl-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which contributes to its basicity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical formulations. The presence of the dimethylamino group indicates that it may exhibit properties related to neurotransmitter modulation, making it of interest in medicinal chemistry. This compound is likely to be a white crystalline solid, and its stability can be influenced by environmental factors such as temperature and humidity. Safety data sheets would typically indicate that it should be handled with care, as it may pose risks such as irritation or toxicity upon exposure. Overall, its unique structural features and solubility profile make it a compound of interest in both research and potential therapeutic applications.
Formula:C8H18N2·ClH
InChI:InChI=1S/C8H18N2.ClH/c1-10(2)7-8-5-3-4-6-9-8;/h8-9H,3-7H2,1-2H3;1H
InChI key:InChIKey=LMHXTWWRCMHMHD-UHFFFAOYSA-N
SMILES:C(N(C)C)C1CCCCN1.Cl
Synonyms:
  • 2-Piperidinemethanamine, N,N-dimethyl-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.