
CAS 1357352-69-2
:7-Chloro-2-(methylsulfonyl)benzoxazole
Description:
7-Chloro-2-(methylsulfonyl)benzoxazole is a chemical compound characterized by its benzoxazole core, which features a chlorine atom at the 7-position and a methylsulfonyl group at the 2-position. This structure contributes to its unique chemical properties, including potential reactivity and solubility characteristics. The presence of the chlorine atom can enhance the compound's electrophilic nature, making it useful in various chemical reactions. The methylsulfonyl group is known for its ability to act as a leaving group in nucleophilic substitution reactions and can also influence the compound's polarity and solubility in organic solvents. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its specific applications and behavior in biological systems would depend on further studies, including its interaction with biological targets and its pharmacokinetic properties. Overall, 7-Chloro-2-(methylsulfonyl)benzoxazole represents a versatile structure with potential implications in medicinal chemistry and organic synthesis.
Formula:C8H6ClNO3S
InChI:InChI=1S/C8H6ClNO3S/c1-14(11,12)8-10-6-4-2-3-5(9)7(6)13-8/h2-4H,1H3
InChI key:InChIKey=FKIXIMNODRHGML-UHFFFAOYSA-N
SMILES:ClC1=C2C(N=C(S(C)(=O)=O)O2)=CC=C1
Synonyms:- Benzoxazole, 7-chloro-2-(methylsulfonyl)-
- 7-Chloro-2-(methylsulfonyl)benzoxazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.