CAS 1357353-02-6
:1,1-Dimethylethyl N-2-azabicyclo[2.2.1]hept-5-ylcarbamate
Description:
1,1-Dimethylethyl N-2-azabicyclo[2.2.1]hept-5-ylcarbamate, identified by its CAS number 1357353-02-6, is a chemical compound characterized by its unique bicyclic structure and functional groups. It features a carbamate moiety, which is indicative of its potential biological activity, particularly in medicinal chemistry. The presence of the 2-azabicyclo[2.2.1]heptane framework suggests that it may exhibit interesting conformational properties and interactions due to its rigid structure. The dimethyl substituent on the nitrogen atom contributes to steric hindrance, which can influence its reactivity and binding affinity in biological systems. This compound may be of interest in the development of pharmaceuticals or agrochemicals, given the significance of bicyclic structures in drug design. Its solubility, stability, and reactivity would depend on the specific conditions, such as pH and temperature, as well as the presence of other chemical species. Overall, the unique structural features of this compound make it a subject of interest for further research in various chemical and biological applications.
Formula:C11H20N2O2
InChI:InChI=1S/C11H20N2O2/c1-11(2,3)15-10(14)13-9-5-8-4-7(9)6-12-8/h7-9,12H,4-6H2,1-3H3,(H,13,14)
InChI key:InChIKey=VERHYGQTHIOMQC-UHFFFAOYSA-N
SMILES:N(C(OC(C)(C)C)=O)C1C2CC(C1)NC2
Synonyms:- 1,1-Dimethylethyl N-2-azabicyclo[2.2.1]hept-5-ylcarbamate
- Carbamic acid, N-2-azabicyclo[2.2.1]hept-5-yl-, 1,1-dimethylethyl ester
- tert-butyl N-(2-azabicyclo[2.2.1]heptan-5-yl)carbamate
- N-Boc-2-azabicyclo[2.2.1]heptan-5-amine
- Tert-Butyl-2-Azabicyclo[2.2.1]Heptan-5-Ylcarbamate(WX120369)
- Tert-Butyl-2-Azabicyclo[2.2.1]Heptan-5-Ylcarbamate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.