CAS 1357354-18-7

1,1-Dimethylethyl 4-(hydroxymethyl)-2,8-diazaspiro[4.5]decane-8-carboxylate

Description:

1,1-Dimethylethyl 4-(hydroxymethyl)-2,8-diazaspiro[4.5]decane-8-carboxylate, identified by its CAS number 1357354-18-7, is a chemical compound characterized by its unique spirocyclic structure, which includes a diazabicyclic framework. This compound features a carboxylate functional group, contributing to its potential reactivity and solubility in various solvents. The presence of a hydroxymethyl group enhances its polarity and may influence its biological activity. The dimethyl group attached to the nitrogen atoms provides steric hindrance, which can affect the compound's conformation and interactions with biological targets. Such structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. The compound's stability, solubility, and reactivity can vary based on environmental conditions, such as pH and temperature. Overall, this compound represents a class of nitrogen-containing heterocycles that may exhibit interesting pharmacological properties, warranting further investigation into its synthesis and potential applications.

Formula: C₁₄H₂₆N₂O₃

InChI: InChI=1S/C14H26N2O3/c1-13(2,3)19-12(18)16-6-4-14(5-7-16)10-15-8-11(14)9-17/h11,15,17H,4-10H2,1-3H3

InChI key: InChIKey=UHJRPLXGZDOQMY-UHFFFAOYSA-N

SMILES: C(O)C1C2(CCN(C(OC(C)(C)C)=O)CC2)CNC1

Synonyms:

• 1,1-Dimethylethyl 4-(hydroxymethyl)-2,8-diazaspiro[4.5]decane-8-carboxylate
• 2,8-Diazaspiro[4.5]decane-8-carboxylic acid, 4-(hydroxymethyl)-, 1,1-dimethylethyl ester

tert-Butyl 4-(hydroxymethyl)-2,8-diazaspiro[4.5]decane-8-carboxylate

CAS: 1357354-18-7

Versatile small molecule scaffold

Formula: C₁₄H₂₆N₂O₃

Purity: Min. 95%

Molecular weight: 270.37 g/mol

Ref: 3D-HEC35418